Eslicarbazepine Acetate
Catalog No: FT-0667969
CAS No: 236395-14-5
- Chemical Name: Eslicarbazepine Acetate
- Molecular Formula: C17H16N2O3
- Molecular Weight: 296.32
- InChI Key: QIALRBLEEWJACW-INIZCTEOSA-N
- InChI: InChI=1S/C17H16N2O3/c1-11(20)22-16-10-12-6-2-4-8-14(12)19(17(18)21)15-9-5-3-7-13(15)16/h2-9,16H,10H2,1H3,(H2,18,21)/t16-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 296.320 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 236395-14-5 |
| Bolling_Point: | 427.4±55.0 °C at 760 mmHg |
| Product_Name: | Eslicarbazepine acetate |
| Melting_Point: | 183-185ºC |
| Flash_Point: | 212.3±31.5 °C |
| MF: | C17H16N2O3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.70 |
| Flash_Point: | 212.3±31.5 °C |
| Melting_Point: | 183-185ºC |
| FW: | 296.320 |
| PSA: | 72.63000 |
| Exact_Mass: | 296.116089 |
| MF: | C17H16N2O3 |
| Bolling_Point: | 427.4±55.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.655 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)